C25H35F2NO4 — CID 146327399
7-[3,3-difluoro-5-[(Z)-7-(3-hydroxy-4-methylphenyl)hept-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 146327399) has the molecular formula C25H35F2NO4 and a molecular weight of 451.55 g/mol. Its IUPAC name is 7-[3,3-difluoro-5-[(Z)-7-(3-hydroxy-4-methylphenyl)hept-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[3,3-difluoro-5-[(Z)-7-(3-hydroxy-4-methylphenyl)hept-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 146327399 |
| Molecular Formula | C25H35F2NO4 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 7-[3,3-difluoro-5-[(Z)-7-(3-hydroxy-4-methylphenyl)hept-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | Cc1ccc(CCCCC/C=C\C2CC(F)(F)C(=O)N2CCCCCCC(=O)O)cc1O |
| InChI | InChI=1S/C25H35F2NO4/c1-19-14-15-20(17-22(19)29)11-7-3-2-4-8-12-21-18-25(26,27)24(32)28(21)16-10-6-5-9-13-23(30)31/h8,12,14-15,17,21,29H,2-7,9-11,13,16,18H2,1H3,(H,30,31)/b12-8- |
| InChIKey | KUBSCATYOXMMLQ-WQLSENKSSA-N |
| XLogP | 5.63 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|