C11H15Br2NO — CID 10830736
(5S)-5-(2,2-dibromoethenyl)-1-pent-4-enylpyrrolidin-2-one (PubChem CID 10830736) has the molecular formula C11H15Br2NO and a molecular weight of 337.06 g/mol. Its IUPAC name is (5S)-5-(2,2-dibromoethenyl)-1-pent-4-enylpyrrolidin-2-one.
| Compound Name | (5S)-5-(2,2-dibromoethenyl)-1-pent-4-enylpyrrolidin-2-one |
|---|---|
| PubChem CID | 10830736 |
| Molecular Formula | C11H15Br2NO |
| Molecular Weight | 337.06 g/mol |
| Exact Mass | 334.95 |
| IUPAC Name | (5S)-5-(2,2-dibromoethenyl)-1-pent-4-enylpyrrolidin-2-one |
| SMILES | C=CCCCN1C(=O)CC[C@H]1C=C(Br)Br |
| InChI | InChI=1S/C11H15Br2NO/c1-2-3-4-7-14-9(8-10(12)13)5-6-11(14)15/h2,8-9H,1,3-7H2/t9-/m0/s1 |
| InChIKey | YMMHNBSPVVASPL-VIFPVBQESA-N |
| XLogP | 3.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.06 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|