C24H31NO4 — CID 89437895
ethyl 7-[3-oxo-6-(3-oxo-4-phenylbut-1-enyl)-2,4-dihydropyridin-1-yl]heptanoate (PubChem CID 89437895) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is ethyl 7-[3-oxo-6-(3-oxo-4-phenylbut-1-enyl)-2,4-dihydropyridin-1-yl]heptanoate.
| Compound Name | ethyl 7-[3-oxo-6-(3-oxo-4-phenylbut-1-enyl)-2,4-dihydropyridin-1-yl]heptanoate |
|---|---|
| PubChem CID | 89437895 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | ethyl 7-[3-oxo-6-(3-oxo-4-phenylbut-1-enyl)-2,4-dihydropyridin-1-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCN1CC(=O)CC=C1C=CC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H31NO4/c1-2-29-24(28)12-8-3-4-9-17-25-19-23(27)16-14-21(25)13-15-22(26)18-20-10-6-5-7-11-20/h5-7,10-11,13-15H,2-4,8-9,12,16-19H2,1H3 |
| InChIKey | GQCZGYNVEGXYNX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|