About ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate
ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate (PubChem CID 169092059) has the molecular formula C21H27NO4
and a molecular weight of 357.45 g/mol. Its IUPAC name is ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate.
Molecular Properties
| Compound Name | ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate |
| PubChem CID | 169092059 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate |
| SMILES | CCOC(=O)CCCCCCCN1C(=O)C/C(=C\c2ccccc2)C1=O |
| InChI | InChI=1S/C21H27NO4/c1-2-26-20(24)13-9-4-3-5-10-14-22-19(23)16-18(21(22)25)15-17-11-7-6-8-12-17/h6-8,11-12,15H,2-5,9-10,13-14,16H2,1H3/b18-15+ |
| InChIKey | OLABTYGJZYFDHK-OBGWFSINSA-N |
| XLogP | 3.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate?
The IUPAC name of ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate (CID 169092059) is ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate.
What is the SMILES notation for ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate?
The canonical SMILES for ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate is CCOC(=O)CCCCCCCN1C(=O)C/C(=C\c2ccccc2)C1=O.
What is the InChIKey of ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate?
The InChIKey is OLABTYGJZYFDHK-OBGWFSINSA-N. The full InChI is InChI=1S/C21H27NO4/c1-2-26-20(24)13-9-4-3-5-10-14-22-19(23)16-18(21(22)25)15-17-11-7-6-8-12-17/h6-8,11-12,15H,2-5,9-10,13-14,16H2,1H3/b18-15+.
What are the key properties of ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate?
ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate has a molecular weight of 357.45 g/mol, XLogP of 3.73, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate is sourced from PubChem (CID 169092059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).