C21H27NO4 — CID 169092059
ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate (PubChem CID 169092059) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate.
| Compound Name | ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate |
|---|---|
| PubChem CID | 169092059 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | ethyl 8-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]octanoate |
| SMILES | CCOC(=O)CCCCCCCN1C(=O)C/C(=C\c2ccccc2)C1=O |
| InChI | InChI=1S/C21H27NO4/c1-2-26-20(24)13-9-4-3-5-10-14-22-19(23)16-18(21(22)25)15-17-11-7-6-8-12-17/h6-8,11-12,15H,2-5,9-10,13-14,16H2,1H3/b18-15+ |
| InChIKey | OLABTYGJZYFDHK-OBGWFSINSA-N |
| XLogP | 3.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|