C15H13Cl2NO4 — CID 110458185
ethyl 2-[(3E)-3-[(3,4-dichlorophenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]acetate (PubChem CID 110458185) has the molecular formula C15H13Cl2NO4 and a molecular weight of 342.18 g/mol. Its IUPAC name is ethyl 2-[(3E)-3-[(3,4-dichlorophenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]acetate.
| Compound Name | ethyl 2-[(3E)-3-[(3,4-dichlorophenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 110458185 |
| Molecular Formula | C15H13Cl2NO4 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | ethyl 2-[(3E)-3-[(3,4-dichlorophenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C/C(=C\c2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C15H13Cl2NO4/c1-2-22-14(20)8-18-13(19)7-10(15(18)21)5-9-3-4-11(16)12(17)6-9/h3-6H,2,7-8H2,1H3/b10-5+ |
| InChIKey | VSIPXFIPMNUCQJ-BJMVGYQFSA-N |
| XLogP | 2.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|