C20H24INO4 — CID 175448664
ethyl 7-[3-[(3-iodophenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]heptanoate (PubChem CID 175448664) has the molecular formula C20H24INO4 and a molecular weight of 469.32 g/mol. Its IUPAC name is ethyl 7-[3-[(3-iodophenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]heptanoate.
| Compound Name | ethyl 7-[3-[(3-iodophenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 175448664 |
| Molecular Formula | C20H24INO4 |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | ethyl 7-[3-[(3-iodophenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCN1C(=O)CC(=Cc2cccc(I)c2)C1=O |
| InChI | InChI=1S/C20H24INO4/c1-2-26-19(24)10-5-3-4-6-11-22-18(23)14-16(20(22)25)12-15-8-7-9-17(21)13-15/h7-9,12-13H,2-6,10-11,14H2,1H3 |
| InChIKey | MWSRCMHMAYXTAE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|