C20H26N2O7 — CID 169092062
N-hydroxy-7-[(3E)-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]heptanamide (PubChem CID 169092062) has the molecular formula C20H26N2O7 and a molecular weight of 406.44 g/mol. Its IUPAC name is N-hydroxy-7-[(3E)-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]heptanamide.
| Compound Name | N-hydroxy-7-[(3E)-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]heptanamide |
|---|---|
| PubChem CID | 169092062 |
| Molecular Formula | C20H26N2O7 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-hydroxy-7-[(3E)-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]heptanamide |
| SMILES | COc1cc(/C=C2\CC(=O)N(CCCCCCC(=O)NO)C2=O)cc(OC)c1O |
| InChI | InChI=1S/C20H26N2O7/c1-28-15-10-13(11-16(29-2)19(15)25)9-14-12-18(24)22(20(14)26)8-6-4-3-5-7-17(23)21-27/h9-11,25,27H,3-8,12H2,1-2H3,(H,21,23)/b14-9+ |
| InChIKey | UNLNYPIHZZANHK-NTEUORMPSA-N |
| XLogP | 2.01 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|