C18H22N2O5 — CID 169092075
N-hydroxy-7-[(3E)-3-[(2-hydroxyphenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]heptanamide (PubChem CID 169092075) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is N-hydroxy-7-[(3E)-3-[(2-hydroxyphenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]heptanamide.
| Compound Name | N-hydroxy-7-[(3E)-3-[(2-hydroxyphenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]heptanamide |
|---|---|
| PubChem CID | 169092075 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-hydroxy-7-[(3E)-3-[(2-hydroxyphenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]heptanamide |
| SMILES | O=C(CCCCCCN1C(=O)C/C(=C\c2ccccc2O)C1=O)NO |
| InChI | InChI=1S/C18H22N2O5/c21-15-8-5-4-7-13(15)11-14-12-17(23)20(18(14)24)10-6-2-1-3-9-16(22)19-25/h4-5,7-8,11,21,25H,1-3,6,9-10,12H2,(H,19,22)/b14-11+ |
| InChIKey | DGXTWWOXDVLLDE-SDNWHVSQSA-N |
| XLogP | 1.99 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|