C19H19ClN2O3S — CID 11849156
6-(3-chloro-6-oxobenzo[b][1,4]benzothiazepin-5-yl)-N-hydroxyhexanamide (PubChem CID 11849156) has the molecular formula C19H19ClN2O3S and a molecular weight of 390.89 g/mol. Its IUPAC name is 6-(3-chloro-6-oxobenzo[b][1,4]benzothiazepin-5-yl)-N-hydroxyhexanamide.
| Compound Name | 6-(3-chloro-6-oxobenzo[b][1,4]benzothiazepin-5-yl)-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 11849156 |
| Molecular Formula | C19H19ClN2O3S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 6-(3-chloro-6-oxobenzo[b][1,4]benzothiazepin-5-yl)-N-hydroxyhexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2Sc2ccc(Cl)cc21)NO |
| InChI | InChI=1S/C19H19ClN2O3S/c20-13-9-10-17-15(12-13)22(11-5-1-2-8-18(23)21-25)19(24)14-6-3-4-7-16(14)26-17/h3-4,6-7,9-10,12,25H,1-2,5,8,11H2,(H,21,23) |
| InChIKey | MHQFERJHHNHDED-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|