C20H24N2O4S — CID 12777426
ethyl 6-[4-oxo-2-(5-phenyl-1,2-oxazol-3-yl)-1,3-thiazolidin-3-yl]hexanoate (PubChem CID 12777426) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is ethyl 6-[4-oxo-2-(5-phenyl-1,2-oxazol-3-yl)-1,3-thiazolidin-3-yl]hexanoate.
| Compound Name | ethyl 6-[4-oxo-2-(5-phenyl-1,2-oxazol-3-yl)-1,3-thiazolidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 12777426 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | ethyl 6-[4-oxo-2-(5-phenyl-1,2-oxazol-3-yl)-1,3-thiazolidin-3-yl]hexanoate |
| SMILES | CCOC(=O)CCCCCN1C(=O)CSC1c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C20H24N2O4S/c1-2-25-19(24)11-7-4-8-12-22-18(23)14-27-20(22)16-13-17(26-21-16)15-9-5-3-6-10-15/h3,5-6,9-10,13,20H,2,4,7-8,11-12,14H2,1H3 |
| InChIKey | OOAPETCEACSHCP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|