C19H25N3O4 — CID 129009308
ethyl 5-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)morpholin-4-yl]pentanoate (PubChem CID 129009308) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is ethyl 5-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)morpholin-4-yl]pentanoate.
| Compound Name | ethyl 5-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)morpholin-4-yl]pentanoate |
|---|---|
| PubChem CID | 129009308 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | ethyl 5-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)morpholin-4-yl]pentanoate |
| SMILES | CCOC(=O)CCCCN1CCOCC1c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C19H25N3O4/c1-2-25-17(23)10-6-7-11-22-12-13-24-14-16(22)19-20-18(21-26-19)15-8-4-3-5-9-15/h3-5,8-9,16H,2,6-7,10-14H2,1H3 |
| InChIKey | GCXPNRNRCBLPSA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|