C27H24Br2N2O3 — CID 170941551
5-[4,5-bis(4-bromophenyl)-2-(4-methoxyphenyl)imidazol-1-yl]pentanoic acid (PubChem CID 170941551) has the molecular formula C27H24Br2N2O3 and a molecular weight of 584.31 g/mol. Its IUPAC name is 5-[4,5-bis(4-bromophenyl)-2-(4-methoxyphenyl)imidazol-1-yl]pentanoic acid.
| Compound Name | 5-[4,5-bis(4-bromophenyl)-2-(4-methoxyphenyl)imidazol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 170941551 |
| Molecular Formula | C27H24Br2N2O3 |
| Molecular Weight | 584.31 g/mol |
| Exact Mass | 582.02 |
| IUPAC Name | 5-[4,5-bis(4-bromophenyl)-2-(4-methoxyphenyl)imidazol-1-yl]pentanoic acid |
| SMILES | COc1ccc(-c2nc(-c3ccc(Br)cc3)c(-c3ccc(Br)cc3)n2CCCCC(=O)O)cc1 |
| InChI | InChI=1S/C27H24Br2N2O3/c1-34-23-15-9-20(10-16-23)27-30-25(18-5-11-21(28)12-6-18)26(19-7-13-22(29)14-8-19)31(27)17-3-2-4-24(32)33/h5-16H,2-4,17H2,1H3,(H,32,33) |
| InChIKey | WXRFNXDSQNYWNE-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.31 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|