C13H13N3O5 — CID 82209012
1-(2-carboxyethyl)-5-(4-methoxyphenyl)triazole-4-carboxylic acid (PubChem CID 82209012) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is 1-(2-carboxyethyl)-5-(4-methoxyphenyl)triazole-4-carboxylic acid.
| Compound Name | 1-(2-carboxyethyl)-5-(4-methoxyphenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82209012 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-(2-carboxyethyl)-5-(4-methoxyphenyl)triazole-4-carboxylic acid |
| SMILES | COc1ccc(-c2c(C(=O)O)nnn2CCC(=O)O)cc1 |
| InChI | InChI=1S/C13H13N3O5/c1-21-9-4-2-8(3-5-9)12-11(13(19)20)14-15-16(12)7-6-10(17)18/h2-5H,6-7H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | YUVUYZJVTZZIHM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |