C12H13N3O4 — CID 82209873
1-(2-hydroxyethyl)-5-(3-methoxyphenyl)triazole-4-carboxylic acid (PubChem CID 82209873) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-5-(3-methoxyphenyl)triazole-4-carboxylic acid.
| Compound Name | 1-(2-hydroxyethyl)-5-(3-methoxyphenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82209873 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 1-(2-hydroxyethyl)-5-(3-methoxyphenyl)triazole-4-carboxylic acid |
| SMILES | COc1cccc(-c2c(C(=O)O)nnn2CCO)c1 |
| InChI | InChI=1S/C12H13N3O4/c1-19-9-4-2-3-8(7-9)11-10(12(17)18)13-14-15(11)5-6-16/h2-4,7,16H,5-6H2,1H3,(H,17,18) |
| InChIKey | SZKCARBINTVLOJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |