C14H17N3O3 — CID 102645185
1-butan-2-yl-5-(3-methoxyphenyl)triazole-4-carboxylic acid (PubChem CID 102645185) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-butan-2-yl-5-(3-methoxyphenyl)triazole-4-carboxylic acid.
| Compound Name | 1-butan-2-yl-5-(3-methoxyphenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102645185 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-butan-2-yl-5-(3-methoxyphenyl)triazole-4-carboxylic acid |
| SMILES | CCC(C)n1nnc(C(=O)O)c1-c1cccc(OC)c1 |
| InChI | InChI=1S/C14H17N3O3/c1-4-9(2)17-13(12(14(18)19)15-16-17)10-6-5-7-11(8-10)20-3/h5-9H,4H2,1-3H3,(H,18,19) |
| InChIKey | AMWIIVLNJHZYCO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |