C14H17N3O3 — CID 102642587
1-(4-methoxybutyl)-5-phenyltriazole-4-carboxylic acid (PubChem CID 102642587) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-(4-methoxybutyl)-5-phenyltriazole-4-carboxylic acid.
| Compound Name | 1-(4-methoxybutyl)-5-phenyltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102642587 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-(4-methoxybutyl)-5-phenyltriazole-4-carboxylic acid |
| SMILES | COCCCCn1nnc(C(=O)O)c1-c1ccccc1 |
| InChI | InChI=1S/C14H17N3O3/c1-20-10-6-5-9-17-13(11-7-3-2-4-8-11)12(14(18)19)15-16-17/h2-4,7-8H,5-6,9-10H2,1H3,(H,18,19) |
| InChIKey | LVCGPYGNNQJNOF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|