C13H15N3O4 — CID 102642652
1-(2-methoxyethyl)-5-(2-methoxyphenyl)triazole-4-carboxylic acid (PubChem CID 102642652) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-5-(2-methoxyphenyl)triazole-4-carboxylic acid.
| Compound Name | 1-(2-methoxyethyl)-5-(2-methoxyphenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102642652 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-(2-methoxyethyl)-5-(2-methoxyphenyl)triazole-4-carboxylic acid |
| SMILES | COCCn1nnc(C(=O)O)c1-c1ccccc1OC |
| InChI | InChI=1S/C13H15N3O4/c1-19-8-7-16-12(11(13(17)18)14-15-16)9-5-3-4-6-10(9)20-2/h3-6H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | HUWKXNZGZHWRND-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |