C14H17N3O4 — CID 102642660
1-(2-ethoxyethyl)-5-(2-methoxyphenyl)triazole-4-carboxylic acid (PubChem CID 102642660) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-5-(2-methoxyphenyl)triazole-4-carboxylic acid.
| Compound Name | 1-(2-ethoxyethyl)-5-(2-methoxyphenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102642660 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 1-(2-ethoxyethyl)-5-(2-methoxyphenyl)triazole-4-carboxylic acid |
| SMILES | CCOCCn1nnc(C(=O)O)c1-c1ccccc1OC |
| InChI | InChI=1S/C14H17N3O4/c1-3-21-9-8-17-13(12(14(18)19)15-16-17)10-6-4-5-7-11(10)20-2/h4-7H,3,8-9H2,1-2H3,(H,18,19) |
| InChIKey | GFMKRCIAWIAANF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|