C15H17N3O5 — CID 94946448
1-(3-carboxypropyl)-5-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid (PubChem CID 94946448) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 1-(3-carboxypropyl)-5-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid.
| Compound Name | 1-(3-carboxypropyl)-5-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 94946448 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-(3-carboxypropyl)-5-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid |
| SMILES | COc1ccc(Cc2c(C(=O)O)nnn2CCCC(=O)O)cc1 |
| InChI | InChI=1S/C15H17N3O5/c1-23-11-6-4-10(5-7-11)9-12-14(15(21)22)16-17-18(12)8-2-3-13(19)20/h4-7H,2-3,8-9H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | QEQMTOYOEKDWCP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |