C36H45N3O5S — CID 5013233
5-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanyl-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpentanamide (PubChem CID 5013233) has the molecular formula C36H45N3O5S and a molecular weight of 631.84 g/mol. Its IUPAC name is 5-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanyl-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpentanamide.
| Compound Name | 5-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanyl-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpentanamide |
|---|---|
| PubChem CID | 5013233 |
| Molecular Formula | C36H45N3O5S |
| Molecular Weight | 631.84 g/mol |
| Exact Mass | 631.31 |
| IUPAC Name | 5-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanyl-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpentanamide |
| SMILES | CCCn1c(SCCCCC(=O)N(C)CCc2ccc(OC)c(OC)c2)nc(-c2ccc(OC)cc2)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C36H45N3O5S/c1-7-22-39-35(28-14-18-30(42-4)19-15-28)34(27-12-16-29(41-3)17-13-27)37-36(39)45-24-9-8-10-33(40)38(2)23-21-26-11-20-31(43-5)32(25-26)44-6/h11-20,25H,7-10,21-24H2,1-6H3 |
| InChIKey | DSAWRGWNWYMVPO-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.84 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|