C17H19ClN2OS — CID 67653231
3-phenyl-N-(3-pyridin-4-ylsulfanylpropyl)prop-2-enamide;hydrochloride (PubChem CID 67653231) has the molecular formula C17H19ClN2OS and a molecular weight of 334.87 g/mol. Its IUPAC name is 3-phenyl-N-(3-pyridin-4-ylsulfanylpropyl)prop-2-enamide;hydrochloride.
| Compound Name | 3-phenyl-N-(3-pyridin-4-ylsulfanylpropyl)prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 67653231 |
| Molecular Formula | C17H19ClN2OS |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 3-phenyl-N-(3-pyridin-4-ylsulfanylpropyl)prop-2-enamide;hydrochloride |
| SMILES | Cl.O=C(C=Cc1ccccc1)NCCCSc1ccncc1 |
| InChI | InChI=1S/C17H18N2OS.ClH/c20-17(8-7-15-5-2-1-3-6-15)19-11-4-14-21-16-9-12-18-13-10-16;/h1-3,5-10,12-13H,4,11,14H2,(H,19,20);1H |
| InChIKey | UBPCOOLXCZSDKX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|