C24H32N2O2S — CID 24843657
(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-4-ylsulfanylethyl)prop-2-enamide (PubChem CID 24843657) has the molecular formula C24H32N2O2S and a molecular weight of 412.60 g/mol. Its IUPAC name is (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-4-ylsulfanylethyl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-4-ylsulfanylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 24843657 |
| Molecular Formula | C24H32N2O2S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-4-ylsulfanylethyl)prop-2-enamide |
| SMILES | CC(C)(C)c1cc(/C=C/C(=O)NCCSc2ccncc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H32N2O2S/c1-23(2,3)19-15-17(16-20(22(19)28)24(4,5)6)7-8-21(27)26-13-14-29-18-9-11-25-12-10-18/h7-12,15-16,28H,13-14H2,1-6H3,(H,26,27)/b8-7+ |
| InChIKey | BKGVMHCLVJQGRZ-BQYQJAHWSA-N |
| XLogP | 5.30 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|