C23H31N3O2S — CID 24843658
(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyrimidin-2-ylsulfanylethyl)prop-2-enamide (PubChem CID 24843658) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyrimidin-2-ylsulfanylethyl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyrimidin-2-ylsulfanylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 24843658 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyrimidin-2-ylsulfanylethyl)prop-2-enamide |
| SMILES | CC(C)(C)c1cc(/C=C/C(=O)NCCSc2ncccn2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H31N3O2S/c1-22(2,3)17-14-16(15-18(20(17)28)23(4,5)6)8-9-19(27)24-12-13-29-21-25-10-7-11-26-21/h7-11,14-15,28H,12-13H2,1-6H3,(H,24,27)/b9-8+ |
| InChIKey | FEZADCQGHSXWBG-CMDGGOBGSA-N |
| XLogP | 4.70 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|