C18H19F3N4O4S — CID 3145567
N-[2-[4-tert-butyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylethyl]-3-(5-nitrofuran-2-yl)prop-2-enamide (PubChem CID 3145567) has the molecular formula C18H19F3N4O4S and a molecular weight of 444.44 g/mol. Its IUPAC name is N-[2-[4-tert-butyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylethyl]-3-(5-nitrofuran-2-yl)prop-2-enamide.
| Compound Name | N-[2-[4-tert-butyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylethyl]-3-(5-nitrofuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3145567 |
| Molecular Formula | C18H19F3N4O4S |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-[2-[4-tert-butyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylethyl]-3-(5-nitrofuran-2-yl)prop-2-enamide |
| SMILES | CC(C)(C)c1cc(C(F)(F)F)nc(SCCNC(=O)C=Cc2ccc([N+](=O)[O-])o2)n1 |
| InChI | InChI=1S/C18H19F3N4O4S/c1-17(2,3)12-10-13(18(19,20)21)24-16(23-12)30-9-8-22-14(26)6-4-11-5-7-15(29-11)25(27)28/h4-7,10H,8-9H2,1-3H3,(H,22,26) |
| InChIKey | AGTCHYLPHQOLNO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|