C14H10FN3O5 — CID 5411990
4-fluoro-N'-[(E)-3-(5-nitrofuran-2-yl)prop-2-enoyl]benzohydrazide (PubChem CID 5411990) has the molecular formula C14H10FN3O5 and a molecular weight of 319.25 g/mol. Its IUPAC name is 4-fluoro-N'-[(E)-3-(5-nitrofuran-2-yl)prop-2-enoyl]benzohydrazide.
| Compound Name | 4-fluoro-N'-[(E)-3-(5-nitrofuran-2-yl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 5411990 |
| Molecular Formula | C14H10FN3O5 |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 4-fluoro-N'-[(E)-3-(5-nitrofuran-2-yl)prop-2-enoyl]benzohydrazide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])o1)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H10FN3O5/c15-10-3-1-9(2-4-10)14(20)17-16-12(19)7-5-11-6-8-13(23-11)18(21)22/h1-8H,(H,16,19)(H,17,20)/b7-5+ |
| InChIKey | HXOOESROJHMMSY-FNORWQNLSA-N |
| XLogP | 1.80 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|