C18H13N3O6 — CID 71086806
3-hydroxy-N'-[3-(5-nitrofuran-2-yl)prop-2-enoyl]naphthalene-2-carbohydrazide (PubChem CID 71086806) has the molecular formula C18H13N3O6 and a molecular weight of 367.32 g/mol. Its IUPAC name is 3-hydroxy-N'-[3-(5-nitrofuran-2-yl)prop-2-enoyl]naphthalene-2-carbohydrazide.
| Compound Name | 3-hydroxy-N'-[3-(5-nitrofuran-2-yl)prop-2-enoyl]naphthalene-2-carbohydrazide |
|---|---|
| PubChem CID | 71086806 |
| Molecular Formula | C18H13N3O6 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 3-hydroxy-N'-[3-(5-nitrofuran-2-yl)prop-2-enoyl]naphthalene-2-carbohydrazide |
| SMILES | O=C(C=Cc1ccc([N+](=O)[O-])o1)NNC(=O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C18H13N3O6/c22-15-10-12-4-2-1-3-11(12)9-14(15)18(24)20-19-16(23)7-5-13-6-8-17(27-13)21(25)26/h1-10,22H,(H,19,23)(H,20,24) |
| InChIKey | AIKMRUILKBFKCP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|