About (E)-N'-benzyl-3-(5-nitrofuran-2-yl)-N'-phenylprop-2-enehydrazide
(E)-N'-benzyl-3-(5-nitrofuran-2-yl)-N'-phenylprop-2-enehydrazide (PubChem CID 9075562) has the molecular formula C20H17N3O4
and a molecular weight of 363.37 g/mol. Its IUPAC name is (E)-N'-benzyl-3-(5-nitrofuran-2-yl)-N'-phenylprop-2-enehydrazide.
Molecular Properties
| Compound Name | (E)-N'-benzyl-3-(5-nitrofuran-2-yl)-N'-phenylprop-2-enehydrazide |
| PubChem CID | 9075562 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (E)-N'-benzyl-3-(5-nitrofuran-2-yl)-N'-phenylprop-2-enehydrazide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])o1)NN(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H17N3O4/c24-19(13-11-18-12-14-20(27-18)23(25)26)21-22(17-9-5-2-6-10-17)15-16-7-3-1-4-8-16/h1-14H,15H2,(H,21,24)/b13-11+ |
| InChIKey | FGZPUPGKKQBDFN-ACCUITESSA-N |
| XLogP | 3.94 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-benzyl-3-(5-nitrofuran-2-yl)-N'-phenylprop-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-benzyl-3-(5-nitrofuran-2-yl)-N'-phenylprop-2-enehydrazide?
The IUPAC name of (E)-N'-benzyl-3-(5-nitrofuran-2-yl)-N'-phenylprop-2-enehydrazide (CID 9075562) is (E)-N'-benzyl-3-(5-nitrofuran-2-yl)-N'-phenylprop-2-enehydrazide.
What is the SMILES notation for (E)-N'-benzyl-3-(5-nitrofuran-2-yl)-N'-phenylprop-2-enehydrazide?
The canonical SMILES for (E)-N'-benzyl-3-(5-nitrofuran-2-yl)-N'-phenylprop-2-enehydrazide is O=C(/C=C/c1ccc([N+](=O)[O-])o1)NN(Cc1ccccc1)c1ccccc1.
What is the InChIKey of (E)-N'-benzyl-3-(5-nitrofuran-2-yl)-N'-phenylprop-2-enehydrazide?
The InChIKey is FGZPUPGKKQBDFN-ACCUITESSA-N. The full InChI is InChI=1S/C20H17N3O4/c24-19(13-11-18-12-14-20(27-18)23(25)26)21-22(17-9-5-2-6-10-17)15-16-7-3-1-4-8-16/h1-14H,15H2,(H,21,24)/b13-11+.
What are the key properties of (E)-N'-benzyl-3-(5-nitrofuran-2-yl)-N'-phenylprop-2-enehydrazide?
(E)-N'-benzyl-3-(5-nitrofuran-2-yl)-N'-phenylprop-2-enehydrazide has a molecular weight of 363.37 g/mol, XLogP of 3.94, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-benzyl-3-(5-nitrofuran-2-yl)-N'-phenylprop-2-enehydrazide is sourced from PubChem (CID 9075562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).