C19H21F3N4O4S — CID 4765082
N-[3-[4-tert-butyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropyl]-3-(5-nitrofuran-2-yl)prop-2-enamide (PubChem CID 4765082) has the molecular formula C19H21F3N4O4S and a molecular weight of 458.46 g/mol. Its IUPAC name is N-[3-[4-tert-butyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropyl]-3-(5-nitrofuran-2-yl)prop-2-enamide.
| Compound Name | N-[3-[4-tert-butyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropyl]-3-(5-nitrofuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4765082 |
| Molecular Formula | C19H21F3N4O4S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | N-[3-[4-tert-butyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropyl]-3-(5-nitrofuran-2-yl)prop-2-enamide |
| SMILES | CC(C)(C)c1cc(C(F)(F)F)nc(SCCCNC(=O)C=Cc2ccc([N+](=O)[O-])o2)n1 |
| InChI | InChI=1S/C19H21F3N4O4S/c1-18(2,3)13-11-14(19(20,21)22)25-17(24-13)31-10-4-9-23-15(27)7-5-12-6-8-16(30-12)26(28)29/h5-8,11H,4,9-10H2,1-3H3,(H,23,27) |
| InChIKey | HVNZEIOWMBFYMG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|