C36H55NO5 — CID 85155412
N-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl]-3-[4-hydroxy-3,5-di(pentan-2-yloxy)phenyl]prop-2-enamide (PubChem CID 85155412) has the molecular formula C36H55NO5 and a molecular weight of 581.84 g/mol. Its IUPAC name is N-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl]-3-[4-hydroxy-3,5-di(pentan-2-yloxy)phenyl]prop-2-enamide.
| Compound Name | N-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl]-3-[4-hydroxy-3,5-di(pentan-2-yloxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 85155412 |
| Molecular Formula | C36H55NO5 |
| Molecular Weight | 581.84 g/mol |
| Exact Mass | 581.41 |
| IUPAC Name | N-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl]-3-[4-hydroxy-3,5-di(pentan-2-yloxy)phenyl]prop-2-enamide |
| SMILES | CCCC(C)Oc1cc(C=CC(=O)NCCCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(OC(C)CCC)c1O |
| InChI | InChI=1S/C36H55NO5/c1-11-14-24(3)41-30-22-27(23-31(34(30)40)42-25(4)15-12-2)17-18-32(38)37-19-13-16-26-20-28(35(5,6)7)33(39)29(21-26)36(8,9)10/h17-18,20-25,39-40H,11-16,19H2,1-10H3,(H,37,38) |
| InChIKey | WEDONTCNYGICLR-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.84 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|