C38H59NO5 — CID 10054459
(E)-N-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl]-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enamide (PubChem CID 10054459) has the molecular formula C38H59NO5 and a molecular weight of 609.89 g/mol. Its IUPAC name is (E)-N-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl]-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl]-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 10054459 |
| Molecular Formula | C38H59NO5 |
| Molecular Weight | 609.89 g/mol |
| Exact Mass | 609.44 |
| IUPAC Name | (E)-N-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl]-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enamide |
| SMILES | CCCCCCOc1cc(/C=C/C(=O)NCCCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(OCCCCCC)c1O |
| InChI | InChI=1S/C38H59NO5/c1-9-11-13-15-22-43-32-26-29(27-33(36(32)42)44-23-16-14-12-10-2)19-20-34(40)39-21-17-18-28-24-30(37(3,4)5)35(41)31(25-28)38(6,7)8/h19-20,24-27,41-42H,9-18,21-23H2,1-8H3,(H,39,40)/b20-19+ |
| InChIKey | UUFPECRMQMIGKV-FMQUCBEESA-N |
| XLogP | 9.37 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.89 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|