C37H57NO5 — CID 90922718
N-[4-(3,5-ditert-butyl-4-hydroxyphenyl)butyl]-3-[4-hydroxy-3,5-di(pentan-2-yloxy)phenyl]prop-2-enamide (PubChem CID 90922718) has the molecular formula C37H57NO5 and a molecular weight of 595.87 g/mol. Its IUPAC name is N-[4-(3,5-ditert-butyl-4-hydroxyphenyl)butyl]-3-[4-hydroxy-3,5-di(pentan-2-yloxy)phenyl]prop-2-enamide.
| Compound Name | N-[4-(3,5-ditert-butyl-4-hydroxyphenyl)butyl]-3-[4-hydroxy-3,5-di(pentan-2-yloxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90922718 |
| Molecular Formula | C37H57NO5 |
| Molecular Weight | 595.87 g/mol |
| Exact Mass | 595.42 |
| IUPAC Name | N-[4-(3,5-ditert-butyl-4-hydroxyphenyl)butyl]-3-[4-hydroxy-3,5-di(pentan-2-yloxy)phenyl]prop-2-enamide |
| SMILES | CCCC(C)Oc1cc(C=CC(=O)NCCCCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(OC(C)CCC)c1O |
| InChI | InChI=1S/C37H57NO5/c1-11-15-25(3)42-31-23-28(24-32(35(31)41)43-26(4)16-12-2)18-19-33(39)38-20-14-13-17-27-21-29(36(5,6)7)34(40)30(22-27)37(8,9)10/h18-19,21-26,40-41H,11-17,20H2,1-10H3,(H,38,39) |
| InChIKey | UJFDQCDEVWNBJM-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.87 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|