C20H19N3OS — CID 67739753
(E)-N-(3-pyridin-4-ylsulfanylpropyl)-3-quinolin-3-ylprop-2-enamide (PubChem CID 67739753) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is (E)-N-(3-pyridin-4-ylsulfanylpropyl)-3-quinolin-3-ylprop-2-enamide.
| Compound Name | (E)-N-(3-pyridin-4-ylsulfanylpropyl)-3-quinolin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 67739753 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (E)-N-(3-pyridin-4-ylsulfanylpropyl)-3-quinolin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cnc2ccccc2c1)NCCCSc1ccncc1 |
| InChI | InChI=1S/C20H19N3OS/c24-20(22-10-3-13-25-18-8-11-21-12-9-18)7-6-16-14-17-4-1-2-5-19(17)23-15-16/h1-2,4-9,11-12,14-15H,3,10,13H2,(H,22,24)/b7-6+ |
| InChIKey | KQBYLFGIWYBXDU-VOTSOKGWSA-N |
| XLogP | 3.94 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|