C23H33N5O — CID 3820060
2-[3-[bis(2-methylpropyl)amino]quinoxalin-2-yl]-N-butyl-2-cyanoacetamide (PubChem CID 3820060) has the molecular formula C23H33N5O and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-[3-[bis(2-methylpropyl)amino]quinoxalin-2-yl]-N-butyl-2-cyanoacetamide.
| Compound Name | 2-[3-[bis(2-methylpropyl)amino]quinoxalin-2-yl]-N-butyl-2-cyanoacetamide |
|---|---|
| PubChem CID | 3820060 |
| Molecular Formula | C23H33N5O |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | 2-[3-[bis(2-methylpropyl)amino]quinoxalin-2-yl]-N-butyl-2-cyanoacetamide |
| SMILES | CCCCNC(=O)C(C#N)c1nc2ccccc2nc1N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C23H33N5O/c1-6-7-12-25-23(29)18(13-24)21-22(28(14-16(2)3)15-17(4)5)27-20-11-9-8-10-19(20)26-21/h8-11,16-18H,6-7,12,14-15H2,1-5H3,(H,25,29) |
| InChIKey | HBLLMWXKXCWBEH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|