C22H23N5O2 — CID 21007818
ethyl 2-cyano-2-[3-[ethyl(2-pyridin-4-ylethyl)amino]quinoxalin-2-yl]acetate (PubChem CID 21007818) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is ethyl 2-cyano-2-[3-[ethyl(2-pyridin-4-ylethyl)amino]quinoxalin-2-yl]acetate.
| Compound Name | ethyl 2-cyano-2-[3-[ethyl(2-pyridin-4-ylethyl)amino]quinoxalin-2-yl]acetate |
|---|---|
| PubChem CID | 21007818 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | ethyl 2-cyano-2-[3-[ethyl(2-pyridin-4-ylethyl)amino]quinoxalin-2-yl]acetate |
| SMILES | CCOC(=O)C(C#N)c1nc2ccccc2nc1N(CC)CCc1ccncc1 |
| InChI | InChI=1S/C22H23N5O2/c1-3-27(14-11-16-9-12-24-13-10-16)21-20(17(15-23)22(28)29-4-2)25-18-7-5-6-8-19(18)26-21/h5-10,12-13,17H,3-4,11,14H2,1-2H3 |
| InChIKey | UCBPCRRFMVUBIL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 92.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |