C20H22N4O2 — CID 660884
propan-2-yl 2-[3-[bis(prop-2-enyl)amino]quinoxalin-2-yl]-2-cyanoacetate (PubChem CID 660884) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is propan-2-yl 2-[3-[bis(prop-2-enyl)amino]quinoxalin-2-yl]-2-cyanoacetate.
| Compound Name | propan-2-yl 2-[3-[bis(prop-2-enyl)amino]quinoxalin-2-yl]-2-cyanoacetate |
|---|---|
| PubChem CID | 660884 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | propan-2-yl 2-[3-[bis(prop-2-enyl)amino]quinoxalin-2-yl]-2-cyanoacetate |
| SMILES | C=CCN(CC=C)c1nc2ccccc2nc1C(C#N)C(=O)OC(C)C |
| InChI | InChI=1S/C20H22N4O2/c1-5-11-24(12-6-2)19-18(15(13-21)20(25)26-14(3)4)22-16-9-7-8-10-17(16)23-19/h5-10,14-15H,1-2,11-12H2,3-4H3 |
| InChIKey | RBNWEEZYMCANNK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|