C18H20N4O2 — CID 660457
propan-2-yl 2-cyano-2-(3-pyrrolidin-1-ylquinoxalin-2-yl)acetate (PubChem CID 660457) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is propan-2-yl 2-cyano-2-(3-pyrrolidin-1-ylquinoxalin-2-yl)acetate.
| Compound Name | propan-2-yl 2-cyano-2-(3-pyrrolidin-1-ylquinoxalin-2-yl)acetate |
|---|---|
| PubChem CID | 660457 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | propan-2-yl 2-cyano-2-(3-pyrrolidin-1-ylquinoxalin-2-yl)acetate |
| SMILES | CC(C)OC(=O)C(C#N)c1nc2ccccc2nc1N1CCCC1 |
| InChI | InChI=1S/C18H20N4O2/c1-12(2)24-18(23)13(11-19)16-17(22-9-5-6-10-22)21-15-8-4-3-7-14(15)20-16/h3-4,7-8,12-13H,5-6,9-10H2,1-2H3 |
| InChIKey | YWUWMXFQJIZJLM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 79.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |