C21H28N4O3 — CID 660397
1-methoxypropan-2-yl 2-cyano-2-[3-(dipropylamino)quinoxalin-2-yl]acetate (PubChem CID 660397) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 2-cyano-2-[3-(dipropylamino)quinoxalin-2-yl]acetate.
| Compound Name | 1-methoxypropan-2-yl 2-cyano-2-[3-(dipropylamino)quinoxalin-2-yl]acetate |
|---|---|
| PubChem CID | 660397 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 1-methoxypropan-2-yl 2-cyano-2-[3-(dipropylamino)quinoxalin-2-yl]acetate |
| SMILES | CCCN(CCC)c1nc2ccccc2nc1C(C#N)C(=O)OC(C)COC |
| InChI | InChI=1S/C21H28N4O3/c1-5-11-25(12-6-2)20-19(23-17-9-7-8-10-18(17)24-20)16(13-22)21(26)28-15(3)14-27-4/h7-10,15-16H,5-6,11-12,14H2,1-4H3 |
| InChIKey | GFNAPRNKVNGSSL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 88.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |