C22H26N4O5 — CID 661608
ethyl 1-[3-[1-cyano-2-(2-methoxyethoxy)-2-oxoethyl]quinoxalin-2-yl]piperidine-4-carboxylate (PubChem CID 661608) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is ethyl 1-[3-[1-cyano-2-(2-methoxyethoxy)-2-oxoethyl]quinoxalin-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[1-cyano-2-(2-methoxyethoxy)-2-oxoethyl]quinoxalin-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 661608 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | ethyl 1-[3-[1-cyano-2-(2-methoxyethoxy)-2-oxoethyl]quinoxalin-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2nc3ccccc3nc2C(C#N)C(=O)OCCOC)CC1 |
| InChI | InChI=1S/C22H26N4O5/c1-3-30-21(27)15-8-10-26(11-9-15)20-19(16(14-23)22(28)31-13-12-29-2)24-17-6-4-5-7-18(17)25-20/h4-7,15-16H,3,8-13H2,1-2H3 |
| InChIKey | AWLYQSFQMMAEBO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 114.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|