C27H33N5O — CID 3259038
2-[3-[bis(2-methylpropyl)amino]quinoxalin-2-yl]-2-cyano-N-(2-phenylethyl)acetamide (PubChem CID 3259038) has the molecular formula C27H33N5O and a molecular weight of 443.60 g/mol. Its IUPAC name is 2-[3-[bis(2-methylpropyl)amino]quinoxalin-2-yl]-2-cyano-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[3-[bis(2-methylpropyl)amino]quinoxalin-2-yl]-2-cyano-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 3259038 |
| Molecular Formula | C27H33N5O |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 2-[3-[bis(2-methylpropyl)amino]quinoxalin-2-yl]-2-cyano-N-(2-phenylethyl)acetamide |
| SMILES | CC(C)CN(CC(C)C)c1nc2ccccc2nc1C(C#N)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C27H33N5O/c1-19(2)17-32(18-20(3)4)26-25(30-23-12-8-9-13-24(23)31-26)22(16-28)27(33)29-15-14-21-10-6-5-7-11-21/h5-13,19-20,22H,14-15,17-18H2,1-4H3,(H,29,33) |
| InChIKey | OISMIJBIXSBLKV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |