C22H31N5O2 — CID 7377425
(2S)-2-cyano-2-[3-(dibutylamino)quinoxalin-2-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 7377425) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is (2S)-2-cyano-2-[3-(dibutylamino)quinoxalin-2-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | (2S)-2-cyano-2-[3-(dibutylamino)quinoxalin-2-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 7377425 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | (2S)-2-cyano-2-[3-(dibutylamino)quinoxalin-2-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | CCCCN(CCCC)c1nc2ccccc2nc1[C@@H](C#N)C(=O)NCCOC |
| InChI | InChI=1S/C22H31N5O2/c1-4-6-13-27(14-7-5-2)21-20(17(16-23)22(28)24-12-15-29-3)25-18-10-8-9-11-19(18)26-21/h8-11,17H,4-7,12-15H2,1-3H3,(H,24,28)/t17-/m1/s1 |
| InChIKey | FGGCUGJKKDQLFP-QGZVFWFLSA-N |
| XLogP | 3.41 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|