C25H27ClN6O — CID 3847897
N-butyl-2-[3-[4-(3-chlorophenyl)piperazin-1-yl]quinoxalin-2-yl]-2-cyanoacetamide (PubChem CID 3847897) has the molecular formula C25H27ClN6O and a molecular weight of 462.99 g/mol. Its IUPAC name is N-butyl-2-[3-[4-(3-chlorophenyl)piperazin-1-yl]quinoxalin-2-yl]-2-cyanoacetamide.
| Compound Name | N-butyl-2-[3-[4-(3-chlorophenyl)piperazin-1-yl]quinoxalin-2-yl]-2-cyanoacetamide |
|---|---|
| PubChem CID | 3847897 |
| Molecular Formula | C25H27ClN6O |
| Molecular Weight | 462.99 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-butyl-2-[3-[4-(3-chlorophenyl)piperazin-1-yl]quinoxalin-2-yl]-2-cyanoacetamide |
| SMILES | CCCCNC(=O)C(C#N)c1nc2ccccc2nc1N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C25H27ClN6O/c1-2-3-11-28-25(33)20(17-27)23-24(30-22-10-5-4-9-21(22)29-23)32-14-12-31(13-15-32)19-8-6-7-18(26)16-19/h4-10,16,20H,2-3,11-15H2,1H3,(H,28,33) |
| InChIKey | IQVPITOSAHMAOX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.99 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|