C15H13N3O3S — CID 71907856
ethyl 2-(2-anilino-1-cyano-2-oxoethyl)-1,3-thiazole-4-carboxylate (PubChem CID 71907856) has the molecular formula C15H13N3O3S and a molecular weight of 315.35 g/mol. Its IUPAC name is ethyl 2-(2-anilino-1-cyano-2-oxoethyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(2-anilino-1-cyano-2-oxoethyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 71907856 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | ethyl 2-(2-anilino-1-cyano-2-oxoethyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(C(C#N)C(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C15H13N3O3S/c1-2-21-15(20)12-9-22-14(18-12)11(8-16)13(19)17-10-6-4-3-5-7-10/h3-7,9,11H,2H2,1H3,(H,17,19) |
| InChIKey | PFMDJRHUDIGQKD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |