C17H14N2O3S — CID 95222536
ethyl 2-[(E,1S)-1-cyano-2-oxo-4-phenylbut-3-enyl]-1,3-thiazole-4-carboxylate (PubChem CID 95222536) has the molecular formula C17H14N2O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is ethyl 2-[(E,1S)-1-cyano-2-oxo-4-phenylbut-3-enyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(E,1S)-1-cyano-2-oxo-4-phenylbut-3-enyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 95222536 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | ethyl 2-[(E,1S)-1-cyano-2-oxo-4-phenylbut-3-enyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc([C@@H](C#N)C(=O)/C=C/c2ccccc2)n1 |
| InChI | InChI=1S/C17H14N2O3S/c1-2-22-17(21)14-11-23-16(19-14)13(10-18)15(20)9-8-12-6-4-3-5-7-12/h3-9,11,13H,2H2,1H3/b9-8+/t13-/m0/s1 |
| InChIKey | PFVDWFYEAGGMIO-XEHSLEBBSA-N |
| XLogP | 3.21 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|