C11H6F3N3O2S — CID 135402525
4-methyl-12-(trifluoromethyl)-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),3,12-tetraene-8,10-dione (PubChem CID 135402525) has the molecular formula C11H6F3N3O2S and a molecular weight of 301.25 g/mol. Its IUPAC name is 4-methyl-12-(trifluoromethyl)-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),3,12-tetraene-8,10-dione.
| Compound Name | 4-methyl-12-(trifluoromethyl)-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),3,12-tetraene-8,10-dione |
|---|---|
| PubChem CID | 135402525 |
| Molecular Formula | C11H6F3N3O2S |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 4-methyl-12-(trifluoromethyl)-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),3,12-tetraene-8,10-dione |
| SMILES | Cc1cc2c([nH]c(=O)c3c(=O)[nH]c(C(F)(F)F)nc32)s1 |
| InChI | InChI=1S/C11H6F3N3O2S/c1-3-2-4-6-5(7(18)16-9(4)20-3)8(19)17-10(15-6)11(12,13)14/h2H,1H3,(H,16,18)(H,15,17,19) |
| InChIKey | PWUGIHJFWJJLJF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |