C15H9F3N4O — CID 168585547
6-methyl-2-oxo-4-[2-(trifluoromethyl)-1H-benzimidazol-4-yl]-1H-pyridine-3-carbonitrile (PubChem CID 168585547) has the molecular formula C15H9F3N4O and a molecular weight of 318.26 g/mol. Its IUPAC name is 6-methyl-2-oxo-4-[2-(trifluoromethyl)-1H-benzimidazol-4-yl]-1H-pyridine-3-carbonitrile.
| Compound Name | 6-methyl-2-oxo-4-[2-(trifluoromethyl)-1H-benzimidazol-4-yl]-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168585547 |
| Molecular Formula | C15H9F3N4O |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 6-methyl-2-oxo-4-[2-(trifluoromethyl)-1H-benzimidazol-4-yl]-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2cccc3[nH]c(C(F)(F)F)nc23)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C15H9F3N4O/c1-7-5-9(10(6-19)13(23)20-7)8-3-2-4-11-12(8)22-14(21-11)15(16,17)18/h2-5H,1H3,(H,20,23)(H,21,22) |
| InChIKey | RDEQTHNZEDFYIU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |