C8H11N5OS — CID 106405299
3-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 106405299) has the molecular formula C8H11N5OS and a molecular weight of 225.28 g/mol. Its IUPAC name is 3-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 106405299 |
| Molecular Formula | C8H11N5OS |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 3-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1n[nH]c(=S)n1CCc1ncon1 |
| InChI | InChI=1S/C8H11N5OS/c1-2-7-10-11-8(15)13(7)4-3-6-9-5-14-12-6/h5H,2-4H2,1H3,(H,11,15) |
| InChIKey | PIZVFIKVOPNNEE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|