C6H12N4S — CID 83017824
4-(dimethylamino)-3-ethyl-1H-1,2,4-triazole-5-thione (PubChem CID 83017824) has the molecular formula C6H12N4S and a molecular weight of 172.26 g/mol. Its IUPAC name is 4-(dimethylamino)-3-ethyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(dimethylamino)-3-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 83017824 |
| Molecular Formula | C6H12N4S |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 4-(dimethylamino)-3-ethyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1n[nH]c(=S)n1N(C)C |
| InChI | InChI=1S/C6H12N4S/c1-4-5-7-8-6(11)10(5)9(2)3/h4H2,1-3H3,(H,8,11) |
| InChIKey | ZKFROEWAPVYHDK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|