C7H9F4N3S — CID 106290343
3-ethyl-4-(2,2,3,3-tetrafluoropropyl)-1H-1,2,4-triazole-5-thione (PubChem CID 106290343) has the molecular formula C7H9F4N3S and a molecular weight of 243.23 g/mol. Its IUPAC name is 3-ethyl-4-(2,2,3,3-tetrafluoropropyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-ethyl-4-(2,2,3,3-tetrafluoropropyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 106290343 |
| Molecular Formula | C7H9F4N3S |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 3-ethyl-4-(2,2,3,3-tetrafluoropropyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1n[nH]c(=S)n1CC(F)(F)C(F)F |
| InChI | InChI=1S/C7H9F4N3S/c1-2-4-12-13-6(15)14(4)3-7(10,11)5(8)9/h5H,2-3H2,1H3,(H,13,15) |
| InChIKey | QEUJGIODFCJZKA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|