C8H13F2N3S — CID 165462884
3-(1,1-difluoropropyl)-4-propyl-1H-1,2,4-triazole-5-thione (PubChem CID 165462884) has the molecular formula C8H13F2N3S and a molecular weight of 221.28 g/mol. Its IUPAC name is 3-(1,1-difluoropropyl)-4-propyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(1,1-difluoropropyl)-4-propyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 165462884 |
| Molecular Formula | C8H13F2N3S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 3-(1,1-difluoropropyl)-4-propyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCn1c(C(F)(F)CC)n[nH]c1=S |
| InChI | InChI=1S/C8H13F2N3S/c1-3-5-13-6(8(9,10)4-2)11-12-7(13)14/h3-5H2,1-2H3,(H,12,14) |
| InChIKey | YBJYNIMEYVKJET-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|