C6H7F4N3S — CID 115389679
4-ethyl-3-(1,1,2,2-tetrafluoroethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 115389679) has the molecular formula C6H7F4N3S and a molecular weight of 229.20 g/mol. Its IUPAC name is 4-ethyl-3-(1,1,2,2-tetrafluoroethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-ethyl-3-(1,1,2,2-tetrafluoroethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115389679 |
| Molecular Formula | C6H7F4N3S |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 4-ethyl-3-(1,1,2,2-tetrafluoroethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCn1c(C(F)(F)C(F)F)n[nH]c1=S |
| InChI | InChI=1S/C6H7F4N3S/c1-2-13-4(11-12-5(13)14)6(9,10)3(7)8/h3H,2H2,1H3,(H,12,14) |
| InChIKey | SPGKWKBAZFBUNK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|